Phenylpropanoic acids
Accela Chembio Inc 3-(4-fluorophenyl)propionic Acid | 25g | 459-31-4 | MFCD00060327 | 98% | Shelf Life: 2160 Days | Regular
3-(4-fluorophenyl)propionic Acid | 25g | 459-31-4 | MFCD00060327 | 98% | Shelf Life: 2160 Days | Regular
Apexbio Technology LLC Glycoprotein B (485-492) 25mg
Glycoprotein B 485-492 is a viral glycoprotein-derived peptide fragment from herpes simplex virus (HSV) It is designed to facilitate virus-cell membrane fusion by interacting with cellular membranes thereby promoting HSV entry into host cells Glycoprotein B 485-492 exerts its biological activity primarily through its role as part of the viral fusion machinery in conjunction with glycoproteins H and L Based on these properties Glycoprotein B 485-492 holds research potential in investigating HSV fusion mechanisms antiviral development and antigen-antibody interaction studies in viral entry
eMolecules 5331-42-0 | Ambeed | 2-Cyano-3-phenylpropionic Acid | 250mg | 686660111 | A363424 | MFCD00205073 | 175.187 | C10H9NO2
Ambeed | 2-Cyano-3-phenylpropionic Acid | 250mg | 686660111 | A363424 | 5331-42-0 | MFCD00205073 | 175.187 | C10H9NO2
Medchemexpress LLC 2-phenylpropionic acid | 492-37-5 | MFCD00002650 | 99.7% | 150.18 g/mol | C9H10O2 | 5 G
2-Phenylpropionic acid is a small-molecule organic acid used as an analytical standard and research intermediate. It is a colorless to light-yellow liquid (C9H10O2) with a molecular weight of 150.18 g/mol and documented physical properties, making it suitable for analytical and synthetic applications.
Chem-Impex International, Inc. L-(-)-3-Phenyllactic acid | 20312-36-1 | MFCD00004244 | 5G
L-(-)-3-Phenyllactic acid, 20312-36-1, MFCD00004244, 5G
Sigma Aldrich Fine Chemicals Biosciences Tesaglitazar >=98% (HPLC) | 251565-85-2 | MFCD07784004 | 5MG
Tesaglitazar >=98% (HPLC) | Purity: >=98% (HPLC) | Mol Wt: 408.47 | 251565-85-2 | MFCD07784004 | 5MG
Chem-Impex International, Inc. L-(-)-3-Phenyllactic acid | 20312-36-1 | MFCD00004244 | 25G
L-(-)-3-Phenyllactic acid, 20312-36-1, MFCD00004244, 25G
Chemscene ChemScene | 3-Hydroxy-3-phenylpropanoic acid | 10G | CS-W021936 | 0.97 | 3480-87-3| MFCD00137907 | 166.18
ChemScene | 3-Hydroxy-3-phenylpropanoic acid | 10G | CS-W021936 | 0.97 | 3480-87-3| MFCD00137907 | 166.18
eMolecules 2096333-95-6 | 2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
2-(Methanesulfonyl(N-methoxymethyl)amino)pyrimidine-5-boronic acid, pinacol ester | Combi-Blocks | 2096333-95-6 | MFCD19684127 | 343.210 | C13H22BN3O5S | 96.000 | COCN(c1ncc(cn1)B1OC(C)(C)C(C)(C)O1)S(C)(=O)=O | 1g | 117545104
Accela Chembio Inc 3-(2-bromophenyl)propionic Acid | 25g | 15115-58-9 | MFCD01310791 | 97+% | Shelf Life: 1260 Days | Light Sensitive
3-(2-bromophenyl)propionic Acid | 25g | 15115-58-9 | MFCD01310791 | 97+% | Shelf Life: 1260 Days | Light Sensitive
Medchemexpress LLC Hydrocinnamic acid | 501-52-0 | MFCD00002771 | 99.9% | 150.18 g·mol-1 | C9H10O2 | 1kg
Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activities
Medchemexpress LLC Hydrocinnamic acid-d5 | 35845-62-6 | 99.7% | 155.21 g/mol | C9H5D5O2 | 100mg
Hydrocinnamic acid-d5 is the deuterium labeled Hydrocinnamic acid[1] Hydrocinnamic acid is the major rhizospheric compound with known growth regulatory activities[2]
Chemscene ChemScene | p-(Methoxycarbonylmethyl)aniline | 100G | CS-0028736 | 0.98 | 39552-81-3| MFCD06200783 | 165.19
ChemScene | p-(Methoxycarbonylmethyl)aniline | 100G | CS-0028736 | 0.98 | 39552-81-3| MFCD06200783 | 165.19
Accela Chembio Inc 3-(3-nitrophenyl)propionic Acid | 100g | 1664-57-9 | MFCD01310835 | 97+% | Shelf Life: 1260 Days | Regular
3-(3-nitrophenyl)propionic Acid | 100g | 1664-57-9 | MFCD01310835 | 97+% | Shelf Life: 1260 Days | Regular